Chemical Name: Chromium(III)2-ethylhexanoate
CAS No.: 3444-17-5
Molecular Formula: C8H16CrO2
Molecular Weight: 196.21
Chemical Name: Chromium(III)2-ethylhexanoate
CAS No.: 3444-17-5
Molecular Formula: C8H16CrO2
Molecular Weight: 196.21
Chromium(III)2-ethylhexanoate Quick Details
Chemical Name: Chromium(III)2-ethylhexanoate
CAS No.: 3444-17-5
Molecular Formula: C8H16CrO2
Chemical Structure:
Molecular Weight: 196.21
| CHROMIUM (III) 2-ETHYLHEXANOATE Chemical Properties |
| Boiling point | 489.1℃[at 101 325 Pa] |
| density | 1,01 g/cm3 |
| Fp | 110°C |
| form | liquid |
| Specific Gravity | 1.01 |
| color | green, viscous |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| Exposure limits | NIOSH: IDLH 25 mg/m3; TWA 0.5 mg/m3 |
| InChI | InChI=1S/C8H16O2.Cr/c1-3-5-6-7(4-2)8(9)10;/h7H,3-6H2,1-2H3,(H,9,10); |
| InChIKey | NPCUWXDZFXSRLT-UHFFFAOYSA-N |
| SMILES | C(CC)(C(=O)O)CCCC.[Cr] |
| LogP | 7.64 |
Chromium(III) 2-ethylhexanoate is used in paints, coatings and petrochemical manufacturing.